C7H23N2O6P — CID 174561283
1-amino-1-ethoxyethanol;N,N-dimethylmethanamine;phosphoric acid (PubChem CID 174561283) has the molecular formula C7H23N2O6P and a molecular weight of 262.24 g/mol. Its IUPAC name is 1-amino-1-ethoxyethanol;N,N-dimethylmethanamine;phosphoric acid.
| Compound Name | 1-amino-1-ethoxyethanol;N,N-dimethylmethanamine;phosphoric acid |
|---|---|
| PubChem CID | 174561283 |
| Molecular Formula | C7H23N2O6P |
| Molecular Weight | 262.24 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 1-amino-1-ethoxyethanol;N,N-dimethylmethanamine;phosphoric acid |
| SMILES | CCOC(C)(N)O.CN(C)C.O=P(O)(O)O |
| InChI | InChI=1S/C4H11NO2.C3H9N.H3O4P/c1-3-7-4(2,5)6;1-4(2)3;1-5(2,3)4/h6H,3,5H2,1-2H3;1-3H3;(H3,1,2,3,4) |
| InChIKey | XLSMLATZOHQIME-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 136.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.24 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|