C7H4F12O2 — CID 45074727
2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanal;hydrate (PubChem CID 45074727) has the molecular formula C7H4F12O2 and a molecular weight of 348.08 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanal;hydrate.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanal;hydrate |
|---|---|
| PubChem CID | 45074727 |
| Molecular Formula | C7H4F12O2 |
| Molecular Weight | 348.08 g/mol |
| Exact Mass | 348.00 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptanal;hydrate |
| SMILES | O.O=CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C7H2F12O.H2O/c8-2(9)4(12,13)6(16,17)7(18,19)5(14,15)3(10,11)1-20;/h1-2H;1H2 |
| InChIKey | GBQQXQLXFLWITB-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 48.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.08 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|