C13H11F17 — CID 174780753
ethane;4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundec-2-ene (PubChem CID 174780753) has the molecular formula C13H11F17 and a molecular weight of 490.20 g/mol. Its IUPAC name is ethane;4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundec-2-ene.
| Compound Name | ethane;4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundec-2-ene |
|---|---|
| PubChem CID | 174780753 |
| Molecular Formula | C13H11F17 |
| Molecular Weight | 490.20 g/mol |
| Exact Mass | 490.06 |
| IUPAC Name | ethane;4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundec-2-ene |
| SMILES | CC.CC=CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H5F17.C2H6/c1-2-3-4(12,13)5(14,15)6(16,17)7(18,19)8(20,21)9(22,23)10(24,25)11(26,27)28;1-2/h2-3H,1H3;1-2H3 |
| InChIKey | IPARSGXRTSNPDN-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.20 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|