C14H10F18 — CID 160505772
4,5,5,6,6,6-hexafluoro-4-(trifluoromethyl)hex-2-ene (PubChem CID 160505772) has the molecular formula C14H10F18 and a molecular weight of 520.20 g/mol. Its IUPAC name is 4,5,5,6,6,6-hexafluoro-4-(trifluoromethyl)hex-2-ene.
| Compound Name | 4,5,5,6,6,6-hexafluoro-4-(trifluoromethyl)hex-2-ene |
|---|---|
| PubChem CID | 160505772 |
| Molecular Formula | C14H10F18 |
| Molecular Weight | 520.20 g/mol |
| Exact Mass | 520.05 |
| IUPAC Name | 4,5,5,6,6,6-hexafluoro-4-(trifluoromethyl)hex-2-ene |
| SMILES | CC=CC(F)(C(F)(F)F)C(F)(F)C(F)(F)F.CC=CC(F)(C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/2C7H5F9/c2*1-2-3-4(8,6(11,12)13)5(9,10)7(14,15)16/h2*2-3H,1H3 |
| InChIKey | QSJOEGSYDYAMID-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.20 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|