C9H2F16 — CID 87098662
(E)-1,1,1,2,5,6,6,7,7,7-decafluoro-2,5-bis(trifluoromethyl)hept-3-ene (PubChem CID 87098662) has the molecular formula C9H2F16 and a molecular weight of 414.08 g/mol. Its IUPAC name is (E)-1,1,1,2,5,6,6,7,7,7-decafluoro-2,5-bis(trifluoromethyl)hept-3-ene.
| Compound Name | (E)-1,1,1,2,5,6,6,7,7,7-decafluoro-2,5-bis(trifluoromethyl)hept-3-ene |
|---|---|
| PubChem CID | 87098662 |
| Molecular Formula | C9H2F16 |
| Molecular Weight | 414.08 g/mol |
| Exact Mass | 413.99 |
| IUPAC Name | (E)-1,1,1,2,5,6,6,7,7,7-decafluoro-2,5-bis(trifluoromethyl)hept-3-ene |
| SMILES | FC(F)(F)C(F)(F)C(F)(/C=C/C(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H2F16/c10-3(6(14,15)16,5(12,13)9(23,24)25)1-2-4(11,7(17,18)19)8(20,21)22/h1-2H/b2-1+ |
| InChIKey | SPCJQBWPTGIYJG-OWOJBTEDSA-N |
| XLogP | 5.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.08 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|