C8H4F12 — CID 121267619
(E)-4,4-bis(difluoromethyl)-1,1,1,5,5,6,6,6-octafluorohex-2-ene (PubChem CID 121267619) has the molecular formula C8H4F12 and a molecular weight of 328.10 g/mol. Its IUPAC name is (E)-4,4-bis(difluoromethyl)-1,1,1,5,5,6,6,6-octafluorohex-2-ene.
| Compound Name | (E)-4,4-bis(difluoromethyl)-1,1,1,5,5,6,6,6-octafluorohex-2-ene |
|---|---|
| PubChem CID | 121267619 |
| Molecular Formula | C8H4F12 |
| Molecular Weight | 328.10 g/mol |
| Exact Mass | 328.01 |
| IUPAC Name | (E)-4,4-bis(difluoromethyl)-1,1,1,5,5,6,6,6-octafluorohex-2-ene |
| SMILES | FC(F)C(/C=C/C(F)(F)F)(C(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H4F12/c9-3(10)5(4(11)12,1-2-6(13,14)15)7(16,17)8(18,19)20/h1-4H/b2-1+ |
| InChIKey | MAHDGIJINVQWCH-OWOJBTEDSA-N |
| XLogP | 4.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.10 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|