C5H2Cl2F6 — CID 168864635
4,4-dichloro-1,1,1,5,5,5-hexafluoropent-2-ene (PubChem CID 168864635) has the molecular formula C5H2Cl2F6 and a molecular weight of 246.97 g/mol. Its IUPAC name is 4,4-dichloro-1,1,1,5,5,5-hexafluoropent-2-ene.
| Compound Name | 4,4-dichloro-1,1,1,5,5,5-hexafluoropent-2-ene |
|---|---|
| PubChem CID | 168864635 |
| Molecular Formula | C5H2Cl2F6 |
| Molecular Weight | 246.97 g/mol |
| Exact Mass | 245.94 |
| IUPAC Name | 4,4-dichloro-1,1,1,5,5,5-hexafluoropent-2-ene |
| SMILES | FC(F)(F)C=CC(Cl)(Cl)C(F)(F)F |
| InChI | InChI=1S/C5H2Cl2F6/c6-3(7,5(11,12)13)1-2-4(8,9)10/h1-2H |
| InChIKey | ROEMNYNSNPPJCD-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.97 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|