C7H3F13 — CID 140534073
4,4-bis(difluoromethyl)-1,1,1,2,2,3,3,5,5-nonafluoropentane (PubChem CID 140534073) has the molecular formula C7H3F13 and a molecular weight of 334.08 g/mol. Its IUPAC name is 4,4-bis(difluoromethyl)-1,1,1,2,2,3,3,5,5-nonafluoropentane.
| Compound Name | 4,4-bis(difluoromethyl)-1,1,1,2,2,3,3,5,5-nonafluoropentane |
|---|---|
| PubChem CID | 140534073 |
| Molecular Formula | C7H3F13 |
| Molecular Weight | 334.08 g/mol |
| Exact Mass | 334.00 |
| IUPAC Name | 4,4-bis(difluoromethyl)-1,1,1,2,2,3,3,5,5-nonafluoropentane |
| SMILES | FC(F)C(C(F)F)(C(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H3F13/c8-1(9)4(2(10)11,3(12)13)5(14,15)6(16,17)7(18,19)20/h1-3H |
| InChIKey | MOUQEBCIOGIRMD-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.08 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|