C14H3F27O4 — CID 139797312
2,2,3,3,4,4,5,5,6,6-decafluoro-1-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]ethoxy]hexan-1-ol (PubChem CID 139797312) has the molecular formula C14H3F27O4 and a molecular weight of 748.12 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6-decafluoro-1-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]ethoxy]hexan-1-ol.
| Compound Name | 2,2,3,3,4,4,5,5,6,6-decafluoro-1-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]ethoxy]hexan-1-ol |
|---|---|
| PubChem CID | 139797312 |
| Molecular Formula | C14H3F27O4 |
| Molecular Weight | 748.12 g/mol |
| Exact Mass | 747.96 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6-decafluoro-1-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]ethoxy]hexan-1-ol |
| SMILES | OC(OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C14H3F27O4/c15-1(16)3(17,18)5(21,22)6(23,24)4(19,20)2(42)43-11(34,35)12(36,37)45-14(40,41)13(38,39)44-10(32,33)8(27,28)7(25,26)9(29,30)31/h1-2,42H |
| InChIKey | OMXLXDVTOALLLC-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.12 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|