C10H3F19O2 — CID 57277387
1-(1,2,2,3,3,4,4,5,5,6,6,6-dodecafluorohexoxy)-2,2,3,3,4,4,4-heptafluorobutan-1-ol (PubChem CID 57277387) has the molecular formula C10H3F19O2 and a molecular weight of 516.09 g/mol. Its IUPAC name is 1-(1,2,2,3,3,4,4,5,5,6,6,6-dodecafluorohexoxy)-2,2,3,3,4,4,4-heptafluorobutan-1-ol.
| Compound Name | 1-(1,2,2,3,3,4,4,5,5,6,6,6-dodecafluorohexoxy)-2,2,3,3,4,4,4-heptafluorobutan-1-ol |
|---|---|
| PubChem CID | 57277387 |
| Molecular Formula | C10H3F19O2 |
| Molecular Weight | 516.09 g/mol |
| Exact Mass | 515.98 |
| IUPAC Name | 1-(1,2,2,3,3,4,4,5,5,6,6,6-dodecafluorohexoxy)-2,2,3,3,4,4,4-heptafluorobutan-1-ol |
| SMILES | OC(OC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H3F19O2/c11-1(31-2(30)4(14,15)6(18,19)9(24,25)26)3(12,13)5(16,17)7(20,21)8(22,23)10(27,28)29/h1-2,30H |
| InChIKey | SLJSGXPZQYOVTE-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.09 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|