C7H2F14 — CID 162621477
1,1,3,4,4,5,5,6,6,6-decafluoro-3-(trifluoromethyl)hex-1-ene;hydrofluoride (PubChem CID 162621477) has the molecular formula C7H2F14 and a molecular weight of 352.07 g/mol. Its IUPAC name is 1,1,3,4,4,5,5,6,6,6-decafluoro-3-(trifluoromethyl)hex-1-ene;hydrofluoride.
| Compound Name | 1,1,3,4,4,5,5,6,6,6-decafluoro-3-(trifluoromethyl)hex-1-ene;hydrofluoride |
|---|---|
| PubChem CID | 162621477 |
| Molecular Formula | C7H2F14 |
| Molecular Weight | 352.07 g/mol |
| Exact Mass | 351.99 |
| IUPAC Name | 1,1,3,4,4,5,5,6,6,6-decafluoro-3-(trifluoromethyl)hex-1-ene;hydrofluoride |
| SMILES | F.FC(F)=CC(F)(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7HF13.FH/c8-2(9)1-3(10,6(15,16)17)4(11,12)5(13,14)7(18,19)20;/h1H;1H |
| InChIKey | XETIULGMFNKPIC-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.07 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|