C9H2F16 — CID 159211842
1,1,3,4,4,5,5,6,6,7,8,8,8-tridecafluoro-3-(trifluoromethyl)oct-1-ene (PubChem CID 159211842) has the molecular formula C9H2F16 and a molecular weight of 414.08 g/mol. Its IUPAC name is 1,1,3,4,4,5,5,6,6,7,8,8,8-tridecafluoro-3-(trifluoromethyl)oct-1-ene.
| Compound Name | 1,1,3,4,4,5,5,6,6,7,8,8,8-tridecafluoro-3-(trifluoromethyl)oct-1-ene |
|---|---|
| PubChem CID | 159211842 |
| Molecular Formula | C9H2F16 |
| Molecular Weight | 414.08 g/mol |
| Exact Mass | 413.99 |
| IUPAC Name | 1,1,3,4,4,5,5,6,6,7,8,8,8-tridecafluoro-3-(trifluoromethyl)oct-1-ene |
| SMILES | FC(F)=CC(F)(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C9H2F16/c10-2(11)1-4(13,9(23,24)25)7(19,20)8(21,22)5(14,15)3(12)6(16,17)18/h1,3H |
| InChIKey | CVWLBBFSUCENIV-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.08 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|