C10H3BF20O3 — CID 142730905
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,10,10,10-icosafluorodecoxyboronic acid (PubChem CID 142730905) has the molecular formula C10H3BF20O3 and a molecular weight of 561.90 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,10,10,10-icosafluorodecoxyboronic acid.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,10,10,10-icosafluorodecoxyboronic acid |
|---|---|
| PubChem CID | 142730905 |
| Molecular Formula | C10H3BF20O3 |
| Molecular Weight | 561.90 g/mol |
| Exact Mass | 561.99 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,10,10,10-icosafluorodecoxyboronic acid |
| SMILES | OB(O)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C10H3BF20O3/c12-1(3(15,16)17)2(13,14)4(18,19)5(20,21)6(22,23)7(24,25)8(26,27)9(28,29)10(30,31)34-11(32)33/h1,32-33H |
| InChIKey | JNLUVKWKYHWLLI-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.90 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|