C16H12F22O — CID 139622993
1,1,2,2,3,3,4,4,5,5,6-undecafluoro-1-(1,1,2,2,3,3,4,4,5,5,6-undecafluorooctoxy)octane (PubChem CID 139622993) has the molecular formula C16H12F22O and a molecular weight of 638.23 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6-undecafluoro-1-(1,1,2,2,3,3,4,4,5,5,6-undecafluorooctoxy)octane.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6-undecafluoro-1-(1,1,2,2,3,3,4,4,5,5,6-undecafluorooctoxy)octane |
|---|---|
| PubChem CID | 139622993 |
| Molecular Formula | C16H12F22O |
| Molecular Weight | 638.23 g/mol |
| Exact Mass | 638.05 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6-undecafluoro-1-(1,1,2,2,3,3,4,4,5,5,6-undecafluorooctoxy)octane |
| SMILES | CCC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)CC |
| InChI | InChI=1S/C16H12F22O/c1-3-5(17)7(19,20)9(23,24)11(27,28)13(31,32)15(35,36)39-16(37,38)14(33,34)12(29,30)10(25,26)8(21,22)6(18)4-2/h5-6H,3-4H2,1-2H3 |
| InChIKey | RIEBFYFNLXOCER-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.23 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|