C13H11F15O6S — CID 18954963
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8-pentadecafluorodecyl 2-sulfooxypropanoate (PubChem CID 18954963) has the molecular formula C13H11F15O6S and a molecular weight of 580.26 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8-pentadecafluorodecyl 2-sulfooxypropanoate.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8-pentadecafluorodecyl 2-sulfooxypropanoate |
|---|---|
| PubChem CID | 18954963 |
| Molecular Formula | C13H11F15O6S |
| Molecular Weight | 580.26 g/mol |
| Exact Mass | 580.00 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8-pentadecafluorodecyl 2-sulfooxypropanoate |
| SMILES | CCC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)OC(=O)C(C)OS(=O)(=O)O |
| InChI | InChI=1S/C13H11F15O6S/c1-3-5(14)7(15,16)8(17,18)9(19,20)10(21,22)11(23,24)12(25,26)13(27,28)33-6(29)4(2)34-35(30,31)32/h4-5H,3H2,1-2H3,(H,30,31,32) |
| InChIKey | LMFAJEOBLQBYDS-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.26 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|