C5H6F6Zr+2 — CID 19359359
1,1,1,2,2,3-hexafluoropentane;zirconium(2+) (PubChem CID 19359359) has the molecular formula C5H6F6Zr+2 and a molecular weight of 271.31 g/mol. Its IUPAC name is 1,1,1,2,2,3-hexafluoropentane;zirconium(2+).
| Compound Name | 1,1,1,2,2,3-hexafluoropentane;zirconium(2+) |
|---|---|
| PubChem CID | 19359359 |
| Molecular Formula | C5H6F6Zr+2 |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 269.94 |
| IUPAC Name | 1,1,1,2,2,3-hexafluoropentane;zirconium(2+) |
| SMILES | CCC(F)C(F)(F)C(F)(F)F.[Zr+2] |
| InChI | InChI=1S/C5H6F6.Zr/c1-2-3(6)4(7,8)5(9,10)11;/h3H,2H2,1H3;/q;+2 |
| InChIKey | MOLOWLPQETVSMM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|