C8H7F11O — CID 162347256
1,1,1,2,3,3,4,5-octafluoro-4-(trifluoromethyl)heptan-2-ol (PubChem CID 162347256) has the molecular formula C8H7F11O and a molecular weight of 328.12 g/mol. Its IUPAC name is 1,1,1,2,3,3,4,5-octafluoro-4-(trifluoromethyl)heptan-2-ol.
| Compound Name | 1,1,1,2,3,3,4,5-octafluoro-4-(trifluoromethyl)heptan-2-ol |
|---|---|
| PubChem CID | 162347256 |
| Molecular Formula | C8H7F11O |
| Molecular Weight | 328.12 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | 1,1,1,2,3,3,4,5-octafluoro-4-(trifluoromethyl)heptan-2-ol |
| SMILES | CCC(F)C(F)(C(F)(F)F)C(F)(F)C(O)(F)C(F)(F)F |
| InChI | InChI=1S/C8H7F11O/c1-2-3(9)4(10,7(14,15)16)5(11,12)6(13,20)8(17,18)19/h3,20H,2H2,1H3 |
| InChIKey | CLBOQTCXMFKGOW-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.12 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |