C7H10F6O2 — CID 141036292
1,2,2,3,3,4-hexafluoroheptane-1,1-diol (PubChem CID 141036292) has the molecular formula C7H10F6O2 and a molecular weight of 240.14 g/mol. Its IUPAC name is 1,2,2,3,3,4-hexafluoroheptane-1,1-diol.
| Compound Name | 1,2,2,3,3,4-hexafluoroheptane-1,1-diol |
|---|---|
| PubChem CID | 141036292 |
| Molecular Formula | C7H10F6O2 |
| Molecular Weight | 240.14 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 1,2,2,3,3,4-hexafluoroheptane-1,1-diol |
| SMILES | CCCC(F)C(F)(F)C(F)(F)C(O)(O)F |
| InChI | InChI=1S/C7H10F6O2/c1-2-3-4(8)5(9,10)6(11,12)7(13,14)15/h4,14-15H,2-3H2,1H3 |
| InChIKey | SUJVZCQQBPKIFF-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.14 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|