C8H6F12 — CID 145149562
3-ethyl-1,1,1,2,2,3,4,5,5,6,6,6-dodecafluorohexane (PubChem CID 145149562) has the molecular formula C8H6F12 and a molecular weight of 330.11 g/mol. Its IUPAC name is 3-ethyl-1,1,1,2,2,3,4,5,5,6,6,6-dodecafluorohexane.
| Compound Name | 3-ethyl-1,1,1,2,2,3,4,5,5,6,6,6-dodecafluorohexane |
|---|---|
| PubChem CID | 145149562 |
| Molecular Formula | C8H6F12 |
| Molecular Weight | 330.11 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | 3-ethyl-1,1,1,2,2,3,4,5,5,6,6,6-dodecafluorohexane |
| SMILES | CCC(F)(C(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H6F12/c1-2-4(10,6(13,14)8(18,19)20)3(9)5(11,12)7(15,16)17/h3H,2H2,1H3 |
| InChIKey | BWYYYOSDTILZKG-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.11 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|