C9H7F13S — CID 174993507
4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononane-3-thiol (PubChem CID 174993507) has the molecular formula C9H7F13S and a molecular weight of 394.20 g/mol. Its IUPAC name is 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononane-3-thiol.
| Compound Name | 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononane-3-thiol |
|---|---|
| PubChem CID | 174993507 |
| Molecular Formula | C9H7F13S |
| Molecular Weight | 394.20 g/mol |
| Exact Mass | 394.01 |
| IUPAC Name | 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononane-3-thiol |
| SMILES | CCC(S)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H7F13S/c1-2-3(23)4(10,11)5(12,13)6(14,15)7(16,17)8(18,19)9(20,21)22/h3,23H,2H2,1H3 |
| InChIKey | GZBHSGVUUNTWRX-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.20 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|