C8H11F9O — CID 87793625
ethoxyethane;1,1,1,2,2,3,3,4,4-nonafluorobutane (PubChem CID 87793625) has the molecular formula C8H11F9O and a molecular weight of 294.16 g/mol. Its IUPAC name is ethoxyethane;1,1,1,2,2,3,3,4,4-nonafluorobutane.
| Compound Name | ethoxyethane;1,1,1,2,2,3,3,4,4-nonafluorobutane |
|---|---|
| PubChem CID | 87793625 |
| Molecular Formula | C8H11F9O |
| Molecular Weight | 294.16 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | ethoxyethane;1,1,1,2,2,3,3,4,4-nonafluorobutane |
| SMILES | CCOCC.FC(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C4HF9.C4H10O/c5-1(6)2(7,8)3(9,10)4(11,12)13;1-3-5-4-2/h1H;3-4H2,1-2H3 |
| InChIKey | KLQGEJUSZZLDMM-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.16 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|