C8H6F12O — CID 170095946
1,1,2,2,3,3,4,5,5-nonafluoro-6-methoxy-4-(trifluoromethyl)hexane (PubChem CID 170095946) has the molecular formula C8H6F12O and a molecular weight of 346.11 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,5,5-nonafluoro-6-methoxy-4-(trifluoromethyl)hexane.
| Compound Name | 1,1,2,2,3,3,4,5,5-nonafluoro-6-methoxy-4-(trifluoromethyl)hexane |
|---|---|
| PubChem CID | 170095946 |
| Molecular Formula | C8H6F12O |
| Molecular Weight | 346.11 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | 1,1,2,2,3,3,4,5,5-nonafluoro-6-methoxy-4-(trifluoromethyl)hexane |
| SMILES | COCC(F)(F)C(F)(C(F)(F)F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C8H6F12O/c1-21-2-4(11,12)6(15,8(18,19)20)7(16,17)5(13,14)3(9)10/h3H,2H2,1H3 |
| InChIKey | RBWTWNCRFLFGPF-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.11 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|