C6H6ClF7O — CID 14093190
5-chloro-1,1,2,2,3,3,4-heptafluoro-4-methoxypentane (PubChem CID 14093190) has the molecular formula C6H6ClF7O and a molecular weight of 262.55 g/mol. Its IUPAC name is 5-chloro-1,1,2,2,3,3,4-heptafluoro-4-methoxypentane.
| Compound Name | 5-chloro-1,1,2,2,3,3,4-heptafluoro-4-methoxypentane |
|---|---|
| PubChem CID | 14093190 |
| Molecular Formula | C6H6ClF7O |
| Molecular Weight | 262.55 g/mol |
| Exact Mass | 262.00 |
| IUPAC Name | 5-chloro-1,1,2,2,3,3,4-heptafluoro-4-methoxypentane |
| SMILES | COC(F)(CCl)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C6H6ClF7O/c1-15-4(10,2-7)6(13,14)5(11,12)3(8)9/h3H,2H2,1H3 |
| InChIKey | ZIOOJCYEUUGWNX-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.55 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|