C11H7F15 — CID 139624021
1,1,3,3,5,5,7,7,9,9,10,10,11,11,11-pentadecafluoroundec-1-ene (PubChem CID 139624021) has the molecular formula C11H7F15 and a molecular weight of 424.15 g/mol. Its IUPAC name is 1,1,3,3,5,5,7,7,9,9,10,10,11,11,11-pentadecafluoroundec-1-ene.
| Compound Name | 1,1,3,3,5,5,7,7,9,9,10,10,11,11,11-pentadecafluoroundec-1-ene |
|---|---|
| PubChem CID | 139624021 |
| Molecular Formula | C11H7F15 |
| Molecular Weight | 424.15 g/mol |
| Exact Mass | 424.03 |
| IUPAC Name | 1,1,3,3,5,5,7,7,9,9,10,10,11,11,11-pentadecafluoroundec-1-ene |
| SMILES | FC(F)=CC(F)(F)CC(F)(F)CC(F)(F)CC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H7F15/c12-5(13)1-6(14,15)2-7(16,17)3-8(18,19)4-9(20,21)10(22,23)11(24,25)26/h1H,2-4H2 |
| InChIKey | JINKIPYSFYAHKQ-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.15 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|