C10H13F11NS+ — CID 152753054
2-(3,3,5,5,6,6,7,7,8,8,8-undecafluorooctylsulfanyl)ethylazanium (PubChem CID 152753054) has the molecular formula C10H13F11NS+ and a molecular weight of 388.27 g/mol. Its IUPAC name is 2-(3,3,5,5,6,6,7,7,8,8,8-undecafluorooctylsulfanyl)ethylazanium.
| Compound Name | 2-(3,3,5,5,6,6,7,7,8,8,8-undecafluorooctylsulfanyl)ethylazanium |
|---|---|
| PubChem CID | 152753054 |
| Molecular Formula | C10H13F11NS+ |
| Molecular Weight | 388.27 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | 2-(3,3,5,5,6,6,7,7,8,8,8-undecafluorooctylsulfanyl)ethylazanium |
| SMILES | [NH3+]CCSCCC(F)(F)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H12F11NS/c11-6(12,1-3-23-4-2-22)5-7(13,14)8(15,16)9(17,18)10(19,20)21/h1-5,22H2/p+1 |
| InChIKey | IOOIDUMIDMHHDW-UHFFFAOYSA-O |
| XLogP | 3.85 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.27 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|