C8H4F13IS — CID 175909062
3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl thiohypoiodite (PubChem CID 175909062) has the molecular formula C8H4F13IS and a molecular weight of 506.07 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl thiohypoiodite.
| Compound Name | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl thiohypoiodite |
|---|---|
| PubChem CID | 175909062 |
| Molecular Formula | C8H4F13IS |
| Molecular Weight | 506.07 g/mol |
| Exact Mass | 505.89 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl thiohypoiodite |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCSI |
| InChI | InChI=1S/C8H4F13IS/c9-3(10,1-2-23-22)4(11,12)5(13,14)6(15,16)7(17,18)8(19,20)21/h1-2H2 |
| InChIKey | UFMSLJWVJSPLCJ-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.07 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|