C20H14F22O4 — CID 90847082
2,3-bis(3,3,5,5,6,6,7,7,8,8,8-undecafluorooctyl)but-2-enedioic acid (PubChem CID 90847082) has the molecular formula C20H14F22O4 and a molecular weight of 736.28 g/mol. Its IUPAC name is 2,3-bis(3,3,5,5,6,6,7,7,8,8,8-undecafluorooctyl)but-2-enedioic acid.
| Compound Name | 2,3-bis(3,3,5,5,6,6,7,7,8,8,8-undecafluorooctyl)but-2-enedioic acid |
|---|---|
| PubChem CID | 90847082 |
| Molecular Formula | C20H14F22O4 |
| Molecular Weight | 736.28 g/mol |
| Exact Mass | 736.05 |
| IUPAC Name | 2,3-bis(3,3,5,5,6,6,7,7,8,8,8-undecafluorooctyl)but-2-enedioic acid |
| SMILES | O=C(O)C(CCC(F)(F)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)=C(CCC(F)(F)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C20H14F22O4/c21-11(22,5-13(25,26)15(29,30)17(33,34)19(37,38)39)3-1-7(9(43)44)8(10(45)46)2-4-12(23,24)6-14(27,28)16(31,32)18(35,36)20(40,41)42/h1-6H2,(H,43,44)(H,45,46) |
| InChIKey | QUAYXRMEKODWSY-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.28 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|