C17H12F18O4 — CID 173017823
2,3-bis(3,3,4,4,5,5,6,6,6-nonafluorohexyl)pent-2-enedioic acid (PubChem CID 173017823) has the molecular formula C17H12F18O4 and a molecular weight of 622.24 g/mol. Its IUPAC name is 2,3-bis(3,3,4,4,5,5,6,6,6-nonafluorohexyl)pent-2-enedioic acid.
| Compound Name | 2,3-bis(3,3,4,4,5,5,6,6,6-nonafluorohexyl)pent-2-enedioic acid |
|---|---|
| PubChem CID | 173017823 |
| Molecular Formula | C17H12F18O4 |
| Molecular Weight | 622.24 g/mol |
| Exact Mass | 622.04 |
| IUPAC Name | 2,3-bis(3,3,4,4,5,5,6,6,6-nonafluorohexyl)pent-2-enedioic acid |
| SMILES | O=C(O)CC(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)=C(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C17H12F18O4/c18-10(19,12(22,23)14(26,27)16(30,31)32)3-1-6(5-8(36)37)7(9(38)39)2-4-11(20,21)13(24,25)15(28,29)17(33,34)35/h1-5H2,(H,36,37)(H,38,39) |
| InChIKey | UUNZDUHAXCIWPE-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.24 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|