C19H13F26NO2 — CID 163324470
3-[bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)amino]propanoic acid (PubChem CID 163324470) has the molecular formula C19H13F26NO2 and a molecular weight of 781.27 g/mol. Its IUPAC name is 3-[bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)amino]propanoic acid.
| Compound Name | 3-[bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)amino]propanoic acid |
|---|---|
| PubChem CID | 163324470 |
| Molecular Formula | C19H13F26NO2 |
| Molecular Weight | 781.27 g/mol |
| Exact Mass | 781.05 |
| IUPAC Name | 3-[bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)amino]propanoic acid |
| SMILES | O=C(O)CCN(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C19H13F26NO2/c20-8(21,10(24,25)12(28,29)14(32,33)16(36,37)18(40,41)42)2-5-46(4-1-7(47)48)6-3-9(22,23)11(26,27)13(30,31)15(34,35)17(38,39)19(43,44)45/h1-6H2,(H,47,48) |
| InChIKey | XNSNNRKDRFZRAD-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.27 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|