C31H16F46O2S2 — CID 101197238
4,4-bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-tricosafluorotridecylsulfanyl)pentanoic acid (PubChem CID 101197238) has the molecular formula C31H16F46O2S2 and a molecular weight of 1358.51 g/mol. Its IUPAC name is 4,4-bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-tricosafluorotridecylsulfanyl)pentanoic acid.
| Compound Name | 4,4-bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-tricosafluorotridecylsulfanyl)pentanoic acid |
|---|---|
| PubChem CID | 101197238 |
| Molecular Formula | C31H16F46O2S2 |
| Molecular Weight | 1358.51 g/mol |
| Exact Mass | 1357.99 |
| IUPAC Name | 4,4-bis(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-tricosafluorotridecylsulfanyl)pentanoic acid |
| SMILES | CC(CCC(=O)O)(SCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)SCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C31H16F46O2S2/c1-9(3-2-8(78)79,80-6-4-10(32,33)12(36,37)14(40,41)16(44,45)18(48,49)20(52,53)22(56,57)24(60,61)26(64,65)28(68,69)30(72,73)74)81-7-5-11(34,35)13(38,39)15(42,43)17(46,47)19(50,51)21(54,55)23(58,59)25(62,63)27(66,67)29(70,71)31(75,76)77/h2-7H2,1H3,(H,78,79) |
| InChIKey | QBVMEFSUEOJPSU-UHFFFAOYSA-N |
| XLogP | 17.64 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 81 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1358.51 |
| LogP ≤ 5 | 17.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|