C23H16F28O4S2 — CID 88786931
4,4-bis(1,3,3,4,4,5,5,6,6,7,7,8,8,8-tetradecafluorooctylsulfanyl)heptanedioic acid (PubChem CID 88786931) has the molecular formula C23H16F28O4S2 and a molecular weight of 952.45 g/mol. Its IUPAC name is 4,4-bis(1,3,3,4,4,5,5,6,6,7,7,8,8,8-tetradecafluorooctylsulfanyl)heptanedioic acid.
| Compound Name | 4,4-bis(1,3,3,4,4,5,5,6,6,7,7,8,8,8-tetradecafluorooctylsulfanyl)heptanedioic acid |
|---|---|
| PubChem CID | 88786931 |
| Molecular Formula | C23H16F28O4S2 |
| Molecular Weight | 952.45 g/mol |
| Exact Mass | 952.00 |
| IUPAC Name | 4,4-bis(1,3,3,4,4,5,5,6,6,7,7,8,8,8-tetradecafluorooctylsulfanyl)heptanedioic acid |
| SMILES | O=C(O)CCC(CCC(=O)O)(SC(F)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)SC(F)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C23H16F28O4S2/c24-7(5-12(26,27)14(30,31)16(34,35)18(38,39)20(42,43)22(46,47)48)56-11(3-1-9(52)53,4-2-10(54)55)57-8(25)6-13(28,29)15(32,33)17(36,37)19(40,41)21(44,45)23(49,50)51/h7-8H,1-6H2,(H,52,53)(H,54,55) |
| InChIKey | OPIVEJDQLJNJLA-UHFFFAOYSA-N |
| XLogP | 11.73 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 952.45 |
| LogP ≤ 5 | 11.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|