C14H8F20OS2 — CID 88644276
2,2-bis(1,3,3,4,4,5,5,6,6,6-decafluorohexylsulfanyl)acetaldehyde (PubChem CID 88644276) has the molecular formula C14H8F20OS2 and a molecular weight of 636.31 g/mol. Its IUPAC name is 2,2-bis(1,3,3,4,4,5,5,6,6,6-decafluorohexylsulfanyl)acetaldehyde.
| Compound Name | 2,2-bis(1,3,3,4,4,5,5,6,6,6-decafluorohexylsulfanyl)acetaldehyde |
|---|---|
| PubChem CID | 88644276 |
| Molecular Formula | C14H8F20OS2 |
| Molecular Weight | 636.31 g/mol |
| Exact Mass | 635.97 |
| IUPAC Name | 2,2-bis(1,3,3,4,4,5,5,6,6,6-decafluorohexylsulfanyl)acetaldehyde |
| SMILES | O=CC(SC(F)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)SC(F)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H8F20OS2/c15-4(1-7(17,18)9(21,22)11(25,26)13(29,30)31)36-6(3-35)37-5(16)2-8(19,20)10(23,24)12(27,28)14(32,33)34/h3-6H,1-2H2 |
| InChIKey | ICONISFAPXQHSI-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.31 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|