C23H12F36OS2 — CID 88793446
2,3-bis(1,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-octadecafluorodecylsulfanyl)propan-1-ol (PubChem CID 88793446) has the molecular formula C23H12F36OS2 and a molecular weight of 1052.41 g/mol. Its IUPAC name is 2,3-bis(1,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-octadecafluorodecylsulfanyl)propan-1-ol.
| Compound Name | 2,3-bis(1,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-octadecafluorodecylsulfanyl)propan-1-ol |
|---|---|
| PubChem CID | 88793446 |
| Molecular Formula | C23H12F36OS2 |
| Molecular Weight | 1052.41 g/mol |
| Exact Mass | 1051.98 |
| IUPAC Name | 2,3-bis(1,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-octadecafluorodecylsulfanyl)propan-1-ol |
| SMILES | OCC(CSC(F)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)SC(F)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C23H12F36OS2/c24-6(1-8(26,27)10(30,31)12(34,35)14(38,39)16(42,43)18(46,47)20(50,51)22(54,55)56)61-4-5(3-60)62-7(25)2-9(28,29)11(32,33)13(36,37)15(40,41)17(44,45)19(48,49)21(52,53)23(57,58)59/h5-7,60H,1-4H2 |
| InChIKey | BBIMKUIERUWODZ-UHFFFAOYSA-N |
| XLogP | 13.20 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1052.41 |
| LogP ≤ 5 | 13.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|