C14H18ClF14NOS — CID 88717550
[2-hydroxy-3-(1,3,3,4,4,5,5,6,6,7,7,8,8,8-tetradecafluorooctylsulfanyl)propyl]-trimethylazanium chloride (PubChem CID 88717550) has the molecular formula C14H18ClF14NOS and a molecular weight of 549.80 g/mol. Its IUPAC name is [2-hydroxy-3-(1,3,3,4,4,5,5,6,6,7,7,8,8,8-tetradecafluorooctylsulfanyl)propyl]-trimethylazanium chloride.
| Compound Name | [2-hydroxy-3-(1,3,3,4,4,5,5,6,6,7,7,8,8,8-tetradecafluorooctylsulfanyl)propyl]-trimethylazanium chloride |
|---|---|
| PubChem CID | 88717550 |
| Molecular Formula | C14H18ClF14NOS |
| Molecular Weight | 549.80 g/mol |
| Exact Mass | 549.06 |
| IUPAC Name | [2-hydroxy-3-(1,3,3,4,4,5,5,6,6,7,7,8,8,8-tetradecafluorooctylsulfanyl)propyl]-trimethylazanium chloride |
| SMILES | C[N+](C)(C)CC(O)CSC(F)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[Cl-] |
| InChI | InChI=1S/C14H18F14NOS.ClH/c1-29(2,3)5-7(30)6-31-8(15)4-9(16,17)10(18,19)11(20,21)12(22,23)13(24,25)14(26,27)28;/h7-8,30H,4-6H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | FKZJBPAGNUWQIJ-UHFFFAOYSA-M |
| XLogP | 2.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.80 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|