C24H14F36OS2 — CID 88797702
3,4-bis(1,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-octadecafluorodecylsulfanyl)butan-1-ol (PubChem CID 88797702) has the molecular formula C24H14F36OS2 and a molecular weight of 1066.44 g/mol. Its IUPAC name is 3,4-bis(1,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-octadecafluorodecylsulfanyl)butan-1-ol.
| Compound Name | 3,4-bis(1,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-octadecafluorodecylsulfanyl)butan-1-ol |
|---|---|
| PubChem CID | 88797702 |
| Molecular Formula | C24H14F36OS2 |
| Molecular Weight | 1066.44 g/mol |
| Exact Mass | 1065.99 |
| IUPAC Name | 3,4-bis(1,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-octadecafluorodecylsulfanyl)butan-1-ol |
| SMILES | OCCC(CSC(F)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)SC(F)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C24H14F36OS2/c25-7(3-9(27,28)11(31,32)13(35,36)15(39,40)17(43,44)19(47,48)21(51,52)23(55,56)57)62-5-6(1-2-61)63-8(26)4-10(29,30)12(33,34)14(37,38)16(41,42)18(45,46)20(49,50)22(53,54)24(58,59)60/h6-8,61H,1-5H2 |
| InChIKey | IIPYCDCBKTVWKB-UHFFFAOYSA-N |
| XLogP | 13.59 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1066.44 |
| LogP ≤ 5 | 13.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|