C24H8F42OS2 — CID 21315344
3,4-bis(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecylsulfanyl)butan-1-ol (PubChem CID 21315344) has the molecular formula C24H8F42OS2 and a molecular weight of 1174.38 g/mol. Its IUPAC name is 3,4-bis(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecylsulfanyl)butan-1-ol.
| Compound Name | 3,4-bis(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecylsulfanyl)butan-1-ol |
|---|---|
| PubChem CID | 21315344 |
| Molecular Formula | C24H8F42OS2 |
| Molecular Weight | 1174.38 g/mol |
| Exact Mass | 1173.93 |
| IUPAC Name | 3,4-bis(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecylsulfanyl)butan-1-ol |
| SMILES | OCCC(CSC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)SC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C24H8F42OS2/c25-5(26,9(33,34)13(41,42)17(49,50)21(57,58)59)7(29,30)11(37,38)15(45,46)19(53,54)23(63,64)68-3-4(1-2-67)69-24(65,66)20(55,56)16(47,48)12(39,40)8(31,32)6(27,28)10(35,36)14(43,44)18(51,52)22(60,61)62/h4,67H,1-3H2 |
| InChIKey | HTCYLXXLNMPHTR-UHFFFAOYSA-N |
| XLogP | 14.68 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1174.38 |
| LogP ≤ 5 | 14.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|