C25H8F42OS2 — CID 19905808
2,2-bis(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecylsulfanylmethyl)oxetane (PubChem CID 19905808) has the molecular formula C25H8F42OS2 and a molecular weight of 1186.39 g/mol. Its IUPAC name is 2,2-bis(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecylsulfanylmethyl)oxetane.
| Compound Name | 2,2-bis(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecylsulfanylmethyl)oxetane |
|---|---|
| PubChem CID | 19905808 |
| Molecular Formula | C25H8F42OS2 |
| Molecular Weight | 1186.39 g/mol |
| Exact Mass | 1185.93 |
| IUPAC Name | 2,2-bis(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecylsulfanylmethyl)oxetane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)SCC1(CSC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCO1 |
| InChI | InChI=1S/C25H8F42OS2/c26-6(27,10(34,35)14(42,43)18(50,51)22(58,59)60)8(30,31)12(38,39)16(46,47)20(54,55)24(64,65)69-3-5(1-2-68-5)4-70-25(66,67)21(56,57)17(48,49)13(40,41)9(32,33)7(28,29)11(36,37)15(44,45)19(52,53)23(61,62)63/h1-4H2 |
| InChIKey | XIRXLGQZRDLICU-UHFFFAOYSA-N |
| XLogP | 15.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1186.39 |
| LogP ≤ 5 | 15.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|