C15H11F21OSi — CID 175106196
[2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl)oxan-2-yl]silane (PubChem CID 175106196) has the molecular formula C15H11F21OSi and a molecular weight of 634.30 g/mol. Its IUPAC name is [2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl)oxan-2-yl]silane.
| Compound Name | [2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl)oxan-2-yl]silane |
|---|---|
| PubChem CID | 175106196 |
| Molecular Formula | C15H11F21OSi |
| Molecular Weight | 634.30 g/mol |
| Exact Mass | 634.02 |
| IUPAC Name | [2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl)oxan-2-yl]silane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1([SiH3])CCCCO1 |
| InChI | InChI=1S/C15H11F21OSi/c16-6(17,5(38)3-1-2-4-37-5)7(18,19)8(20,21)9(22,23)10(24,25)11(26,27)12(28,29)13(30,31)14(32,33)15(34,35)36/h1-4H2,38H3 |
| InChIKey | RSMPLJVPXNHOCB-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.30 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|