About hydron;(2-silyloxan-2-yl)silane
hydron;(2-silyloxan-2-yl)silane (PubChem CID 174620661) has the molecular formula C5H15OSi2+
and a molecular weight of 147.35 g/mol. Its IUPAC name is hydron;(2-silyloxan-2-yl)silane.
Molecular Properties
| Compound Name | hydron;(2-silyloxan-2-yl)silane |
| PubChem CID | 174620661 |
| Molecular Formula | C5H15OSi2+ |
| Molecular Weight | 147.35 g/mol |
| Exact Mass | 147.07 |
| IUPAC Name | hydron;(2-silyloxan-2-yl)silane |
| SMILES | [H+].[SiH3]C1([SiH3])CCCCO1 |
| InChI | InChI=1S/C5H14OSi2/c7-5(8)3-1-2-4-6-5/h1-4H2,7-8H3/p+1 |
| InChIKey | XZINTHSUEATTLI-UHFFFAOYSA-O |
| XLogP | -1.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.35 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze hydron;(2-silyloxan-2-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;(2-silyloxan-2-yl)silane?
The IUPAC name of hydron;(2-silyloxan-2-yl)silane (CID 174620661) is hydron;(2-silyloxan-2-yl)silane.
What is the SMILES notation for hydron;(2-silyloxan-2-yl)silane?
The canonical SMILES for hydron;(2-silyloxan-2-yl)silane is [H+].[SiH3]C1([SiH3])CCCCO1.
What is the InChIKey of hydron;(2-silyloxan-2-yl)silane?
The InChIKey is XZINTHSUEATTLI-UHFFFAOYSA-O. The full InChI is InChI=1S/C5H14OSi2/c7-5(8)3-1-2-4-6-5/h1-4H2,7-8H3/p+1.
What are the key properties of hydron;(2-silyloxan-2-yl)silane?
hydron;(2-silyloxan-2-yl)silane has a molecular weight of 147.35 g/mol, XLogP of -1.32, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;(2-silyloxan-2-yl)silane is sourced from PubChem (CID 174620661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).