C13H14F14OSi — CID 173398102
[2-(1,3,3,4,4,5,5,6,6,7,7,8,8,8-tetradecafluorooctyl)oxan-2-yl]silane (PubChem CID 173398102) has the molecular formula C13H14F14OSi and a molecular weight of 480.31 g/mol. Its IUPAC name is [2-(1,3,3,4,4,5,5,6,6,7,7,8,8,8-tetradecafluorooctyl)oxan-2-yl]silane.
| Compound Name | [2-(1,3,3,4,4,5,5,6,6,7,7,8,8,8-tetradecafluorooctyl)oxan-2-yl]silane |
|---|---|
| PubChem CID | 173398102 |
| Molecular Formula | C13H14F14OSi |
| Molecular Weight | 480.31 g/mol |
| Exact Mass | 480.06 |
| IUPAC Name | [2-(1,3,3,4,4,5,5,6,6,7,7,8,8,8-tetradecafluorooctyl)oxan-2-yl]silane |
| SMILES | FC(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C1([SiH3])CCCCO1 |
| InChI | InChI=1S/C13H14F14OSi/c14-6(7(29)3-1-2-4-28-7)5-8(15,16)9(17,18)10(19,20)11(21,22)12(23,24)13(25,26)27/h6H,1-5H2,29H3 |
| InChIKey | DDMUVALLRUHHSF-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.31 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|