C29H34F26N2O3 — CID 101033486
7,13-bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-1,4,10-trioxa-7,13-diazacyclooctadecane (PubChem CID 101033486) has the molecular formula C29H34F26N2O3 and a molecular weight of 952.55 g/mol. Its IUPAC name is 7,13-bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-1,4,10-trioxa-7,13-diazacyclooctadecane.
| Compound Name | 7,13-bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-1,4,10-trioxa-7,13-diazacyclooctadecane |
|---|---|
| PubChem CID | 101033486 |
| Molecular Formula | C29H34F26N2O3 |
| Molecular Weight | 952.55 g/mol |
| Exact Mass | 952.22 |
| IUPAC Name | 7,13-bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-1,4,10-trioxa-7,13-diazacyclooctadecane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCN1CCCCCOCCOCCN(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCOCC1 |
| InChI | InChI=1S/C29H34F26N2O3/c30-18(31,20(34,35)22(38,39)24(42,43)26(46,47)28(50,51)52)4-7-56-6-2-1-3-12-58-16-17-60-15-11-57(10-14-59-13-9-56)8-5-19(32,33)21(36,37)23(40,41)25(44,45)27(48,49)29(53,54)55/h1-17H2 |
| InChIKey | ILJHFVKVQUGXKO-UHFFFAOYSA-N |
| XLogP | 10.08 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 952.55 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|