C10H15F6NO3S — CID 154516790
1,1,2,2,3,3-hexafluoro-5-piperidin-1-ylpentane-1-sulfonic acid (PubChem CID 154516790) has the molecular formula C10H15F6NO3S and a molecular weight of 343.29 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-5-piperidin-1-ylpentane-1-sulfonic acid.
| Compound Name | 1,1,2,2,3,3-hexafluoro-5-piperidin-1-ylpentane-1-sulfonic acid |
|---|---|
| PubChem CID | 154516790 |
| Molecular Formula | C10H15F6NO3S |
| Molecular Weight | 343.29 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-5-piperidin-1-ylpentane-1-sulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)CCN1CCCCC1 |
| InChI | InChI=1S/C10H15F6NO3S/c11-8(12,4-7-17-5-2-1-3-6-17)9(13,14)10(15,16)21(18,19)20/h1-7H2,(H,18,19,20) |
| InChIKey | GOPZZXGCDJZAOW-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.29 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|