About 1-octylpyrrolidine;trifluoromethanesulfonic acid
1-octylpyrrolidine;trifluoromethanesulfonic acid (PubChem CID 173043377) has the molecular formula C13H26F3NO3S
and a molecular weight of 333.42 g/mol. Its IUPAC name is 1-octylpyrrolidine;trifluoromethanesulfonic acid.
Molecular Properties
| Compound Name | 1-octylpyrrolidine;trifluoromethanesulfonic acid |
| PubChem CID | 173043377 |
| Molecular Formula | C13H26F3NO3S |
| Molecular Weight | 333.42 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 1-octylpyrrolidine;trifluoromethanesulfonic acid |
| SMILES | CCCCCCCCN1CCCC1.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C12H25N.CHF3O3S/c1-2-3-4-5-6-7-10-13-11-8-9-12-13;2-1(3,4)8(5,6)7/h2-12H2,1H3;(H,5,6,7) |
| InChIKey | STRGXLUTCCEGHD-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.42 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 1-octylpyrrolidine;trifluoromethanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-octylpyrrolidine;trifluoromethanesulfonic acid?
The IUPAC name of 1-octylpyrrolidine;trifluoromethanesulfonic acid (CID 173043377) is 1-octylpyrrolidine;trifluoromethanesulfonic acid.
What is the SMILES notation for 1-octylpyrrolidine;trifluoromethanesulfonic acid?
The canonical SMILES for 1-octylpyrrolidine;trifluoromethanesulfonic acid is CCCCCCCCN1CCCC1.O=S(=O)(O)C(F)(F)F.
What is the InChIKey of 1-octylpyrrolidine;trifluoromethanesulfonic acid?
The InChIKey is STRGXLUTCCEGHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25N.CHF3O3S/c1-2-3-4-5-6-7-10-13-11-8-9-12-13;2-1(3,4)8(5,6)7/h2-12H2,1H3;(H,5,6,7).
What are the key properties of 1-octylpyrrolidine;trifluoromethanesulfonic acid?
1-octylpyrrolidine;trifluoromethanesulfonic acid has a molecular weight of 333.42 g/mol, XLogP of 3.84, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-octylpyrrolidine;trifluoromethanesulfonic acid is sourced from PubChem (CID 173043377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).