C7H16N2O6S2 — CID 15889426
2-piperidin-1-ylethyl(sulfo)sulfamic acid (PubChem CID 15889426) has the molecular formula C7H16N2O6S2 and a molecular weight of 288.35 g/mol. Its IUPAC name is 2-piperidin-1-ylethyl(sulfo)sulfamic acid.
| Compound Name | 2-piperidin-1-ylethyl(sulfo)sulfamic acid |
|---|---|
| PubChem CID | 15889426 |
| Molecular Formula | C7H16N2O6S2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 2-piperidin-1-ylethyl(sulfo)sulfamic acid |
| SMILES | O=S(=O)(O)N(CCN1CCCCC1)S(=O)(=O)O |
| InChI | InChI=1S/C7H16N2O6S2/c10-16(11,12)9(17(13,14)15)7-6-8-4-2-1-3-5-8/h1-7H2,(H,10,11,12)(H,13,14,15) |
| InChIKey | OBRVVOLTBIJPGT-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|