C16H13F21OSi — CID 174146457
[2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl)oxan-2-yl]-methylsilane (PubChem CID 174146457) has the molecular formula C16H13F21OSi and a molecular weight of 648.32 g/mol. Its IUPAC name is [2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl)oxan-2-yl]-methylsilane.
| Compound Name | [2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl)oxan-2-yl]-methylsilane |
|---|---|
| PubChem CID | 174146457 |
| Molecular Formula | C16H13F21OSi |
| Molecular Weight | 648.32 g/mol |
| Exact Mass | 648.04 |
| IUPAC Name | [2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecyl)oxan-2-yl]-methylsilane |
| SMILES | C[SiH2]C1(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCCCO1 |
| InChI | InChI=1S/C16H13F21OSi/c1-39-6(4-2-3-5-38-6)7(17,18)8(19,20)9(21,22)10(23,24)11(25,26)12(27,28)13(29,30)14(31,32)15(33,34)16(35,36)37/h2-5,39H2,1H3 |
| InChIKey | VGJUPSDHNYDDOJ-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.32 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|