C8H2F18OS — CID 86747578
1,1,1,2,2,3,3,4,4-nonafluoro-4-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfanyl)butane;hydrate (PubChem CID 86747578) has the molecular formula C8H2F18OS and a molecular weight of 488.13 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4-nonafluoro-4-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfanyl)butane;hydrate.
| Compound Name | 1,1,1,2,2,3,3,4,4-nonafluoro-4-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfanyl)butane;hydrate |
|---|---|
| PubChem CID | 86747578 |
| Molecular Formula | C8H2F18OS |
| Molecular Weight | 488.13 g/mol |
| Exact Mass | 487.95 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4-nonafluoro-4-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfanyl)butane;hydrate |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)SC(F)(F)C(F)(F)C(F)(F)C(F)(F)F.O |
| InChI | InChI=1S/C8F18S.H2O/c9-1(10,5(17,18)19)3(13,14)7(23,24)27-8(25,26)4(15,16)2(11,12)6(20,21)22;/h;1H2 |
| InChIKey | RWOOCHVZTPVCRP-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 31.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.13 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|