C12H6F13NS — CID 102393330
4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfanyl)aniline (PubChem CID 102393330) has the molecular formula C12H6F13NS and a molecular weight of 443.23 g/mol. Its IUPAC name is 4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfanyl)aniline.
| Compound Name | 4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfanyl)aniline |
|---|---|
| PubChem CID | 102393330 |
| Molecular Formula | C12H6F13NS |
| Molecular Weight | 443.23 g/mol |
| Exact Mass | 443.00 |
| IUPAC Name | 4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfanyl)aniline |
| SMILES | Nc1ccc(SC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H6F13NS/c13-7(14,9(17,18)11(21,22)23)8(15,16)10(19,20)12(24,25)27-6-3-1-5(26)2-4-6/h1-4H,26H2 |
| InChIKey | PPLWZJIMSUNCOW-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.23 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|