C9H7BrF4S — CID 12780692
1-(2-bromo-1,1,2,2-tetrafluoroethyl)sulfanyl-4-methylbenzene (PubChem CID 12780692) has the molecular formula C9H7BrF4S and a molecular weight of 303.12 g/mol. Its IUPAC name is 1-(2-bromo-1,1,2,2-tetrafluoroethyl)sulfanyl-4-methylbenzene.
| Compound Name | 1-(2-bromo-1,1,2,2-tetrafluoroethyl)sulfanyl-4-methylbenzene |
|---|---|
| PubChem CID | 12780692 |
| Molecular Formula | C9H7BrF4S |
| Molecular Weight | 303.12 g/mol |
| Exact Mass | 301.94 |
| IUPAC Name | 1-(2-bromo-1,1,2,2-tetrafluoroethyl)sulfanyl-4-methylbenzene |
| SMILES | Cc1ccc(SC(F)(F)C(F)(F)Br)cc1 |
| InChI | InChI=1S/C9H7BrF4S/c1-6-2-4-7(5-3-6)15-9(13,14)8(10,11)12/h2-5H,1H3 |
| InChIKey | JUALHJYAYPKAOU-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.12 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|