C8H5BrF4S — CID 12780693
(2-bromo-1,1,2,2-tetrafluoroethyl)sulfanylbenzene (PubChem CID 12780693) has the molecular formula C8H5BrF4S and a molecular weight of 289.09 g/mol. Its IUPAC name is (2-bromo-1,1,2,2-tetrafluoroethyl)sulfanylbenzene.
| Compound Name | (2-bromo-1,1,2,2-tetrafluoroethyl)sulfanylbenzene |
|---|---|
| PubChem CID | 12780693 |
| Molecular Formula | C8H5BrF4S |
| Molecular Weight | 289.09 g/mol |
| Exact Mass | 287.92 |
| IUPAC Name | (2-bromo-1,1,2,2-tetrafluoroethyl)sulfanylbenzene |
| SMILES | FC(F)(Br)C(F)(F)Sc1ccccc1 |
| InChI | InChI=1S/C8H5BrF4S/c9-7(10,11)8(12,13)14-6-4-2-1-3-5-6/h1-5H |
| InChIKey | ACKRNLPIVVTRML-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.09 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|