C12H4BrF13S — CID 156635411
1-bromo-4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfanyl)benzene (PubChem CID 156635411) has the molecular formula C12H4BrF13S and a molecular weight of 507.11 g/mol. Its IUPAC name is 1-bromo-4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfanyl)benzene.
| Compound Name | 1-bromo-4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfanyl)benzene |
|---|---|
| PubChem CID | 156635411 |
| Molecular Formula | C12H4BrF13S |
| Molecular Weight | 507.11 g/mol |
| Exact Mass | 505.90 |
| IUPAC Name | 1-bromo-4-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfanyl)benzene |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Sc1ccc(Br)cc1 |
| InChI | InChI=1S/C12H4BrF13S/c13-5-1-3-6(4-2-5)27-12(25,26)10(20,21)8(16,17)7(14,15)9(18,19)11(22,23)24/h1-4H |
| InChIKey | JMTKXDHOWANQBM-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.11 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|